Online Database of Chemicals from Around the World
| Name | 1-(4-Methoxyphenyl)Ethyl Propanoate |
|---|---|
| Synonyms | Propanoic Acid 1-(4-Methoxyphenyl)Ethyl Ester; Propionic Acid 1-(4-Methoxyphenyl)Ethyl Ester; 4-Methoxy-Alpha-Methylbenzyl Propionate |
| Molecular Structure |  |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 35279-24-4 |
| EINECS | 252-483-4 |
| SMILES | C1=C(OC)C=CC(=C1)C(OC(=O)CC)C |
| InChI | 1S/C12H16O3/c1-4-12(13)15-9(2)10-5-7-11(14-3)8-6-10/h5-9H,4H2,1-3H3 |
| InChIKey | WNHUSXOIBXEAMM-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.553°C at 760 mmHg (Cal.) |
| Flash point | 112.231°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxyphenyl)Ethyl Propanoate |
