Online Database of Chemicals from Around the World
| Name | 4,5-Dihydroanthanthrene |
|---|---|
| Synonyms | 4,5-Dihydrodibenzo(Def,Mno)Chrysene; Dibenzo(Def,Mno)Chrysene, 4,5-Dihydro- |
| Molecular Structure |  |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 35281-32-4 |
| SMILES | C1=CC=C5C3=C1C=C6C4=C2C(=CC=CC2=CC(=C34)CC5)C=C6 |
| InChI | 1S/C22H14/c1-3-13-7-9-18-12-16-6-2-4-14-8-10-17-11-15(5-1)19(13)21(18)22(17)20(14)16/h1-7,9,11-12H,8,10H2 |
| InChIKey | HIXDHRFUXBDMNW-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.264°C at 760 mmHg (Cal.) |
| Flash point | 253.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydroanthanthrene |
