Online Database of Chemicals from Around the World
|
CAS#: 35281-34-6 Product: 1,2,3,7,8,9-Hexahydroanthanthrene No suppilers available for the product. |
| Name | 1,2,3,7,8,9-Hexahydroanthanthrene |
|---|---|
| Synonyms | 1,2,3,7,8,9-Hexahydrodibenzo(Def,Mno)Chrysene; Dibenzo(Def,Mno)Chrysene, 1,2,3,7,8,9-Hexahydro- |
| Molecular Structure |  |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 35281-34-6 |
| SMILES | C4=C2C=C1CCCC6=C1C3=C(C=C5C(=C23)C(=C4)CCC5)C=C6 |
| InChI | 1S/C22H18/c1-3-13-7-9-18-12-16-6-2-4-14-8-10-17-11-15(5-1)19(13)21(18)22(17)20(14)16/h7-12H,1-6H2 |
| InChIKey | ZSZZSGNVFIHJFK-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.88°C at 760 mmHg (Cal.) |
| Flash point | 261.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,7,8,9-Hexahydroanthanthrene |