Online Database of Chemicals from Around the World
|
CAS#: 35282-69-0 Product: [3-(4-Dimethylaminophenyl)Diazenylphenyl]Methanol No suppilers available for the product. |
| Name | [3-(4-Dimethylaminophenyl)Diazenylphenyl]Methanol |
|---|---|
| Synonyms | [3-(4-Dimethylaminophenyl)Azophenyl]Methanol; 3'-Hydroxymethyl-4-(Dimethylamino)Azobenzene; 3-((4-(Dimethylamino)Phenyl)Azo)Benzenemethanol |
| Molecular Structure | ![CAS#: 35282-69-0， [3-(4-Dimethylaminophenyl)Diazenylphenyl]Methanol](/moreStructures/35282-69-0.gif) |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 |
| CAS Registry Number | 35282-69-0 |
| SMILES | C1=C(C=CC(=C1)N(C)C)N=NC2=CC=CC(=C2)CO |
| InChI | 1S/C15H17N3O/c1-18(2)15-8-6-13(7-9-15)16-17-14-5-3-4-12(10-14)11-19/h3-10,19H,11H2,1-2H3 |
| InChIKey | TWXQGEYDRNHPCH-UHFFFAOYSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.671°C at 760 mmHg (Cal.) |
| Flash point | 222.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-(4-Dimethylaminophenyl)Diazenylphenyl]Methanol |