Online Database of Chemicals from Around the World
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (845) 299-6009/ | |||
 |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-(Oxiran-2-Ylmethoxy)-1H-Indole |
|---|---|
| Synonyms | 4-(2-Oxiranylmethoxy)-1H-Indole; 4-Glycidoxy-1H-Indole; 4-(Oxiranylmethoxy)-1H-Indole |
| Molecular Structure |  |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 35308-87-3 |
| EINECS | 252-506-8 |
| SMILES | C1=C[NH]C2=C1C(=CC=C2)OCC3OC3 |
| InChI | 1S/C11H11NO2/c1-2-10-9(4-5-12-10)11(3-1)14-7-8-6-13-8/h1-5,8,12H,6-7H2 |
| InChIKey | CTWQPSSVUYPWOM-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.177°C at 760 mmHg (Cal.) |
| Flash point | 138.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Oxiran-2-Ylmethoxy)-1H-Indole |