Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-1H-Imidazo[4,5-h]Quinolin-5-Amine |
|---|---|
| Molecular Structure | ![CAS#: 35313-63-4， 2-Methyl-1H-Imidazo[4,5-h]Quinolin-5-Amine](/moreStructures/35313-63-4.gif) |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 35313-63-4 |
| SMILES | CC1=NC2=C(N1)C3=C(C=CC=N3)C(=C2)N |
| InChI | 1S/C11H10N4/c1-6-14-9-5-8(12)7-3-2-4-13-10(7)11(9)15-6/h2-5H,12H2,1H3,(H,14,15) |
| InChIKey | HXIODEFJNWFHCT-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.4±35.0°C at 760 mmHg (Cal.) |
| Flash point | 319.5±13.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1H-Imidazo[4,5-h]Quinolin-5-Amine |