Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Allyl (3S)-3-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)Butanoate |
|---|---|
| Synonyms | (S)-3-(Boc-amino)butyric acid allyl ester; Boc-L-β-homoalanine allyl ester; Boc-β-Homoala-OAll |
| Molecular Structure | ![CAS#: 353296-84-1， Allyl (3S)-3-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)Butanoate](/moreStructures/353296-84-1.gif) |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 |
| CAS Registry Number | 353296-84-1 |
| SMILES | O=C(OC(C)(C)C)N[C@H](CC(=O)OC\C=C)C |
| InChI | 1S/C12H21NO4/c1-6-7-16-10(14)8-9(2)13-11(15)17-12(3,4)5/h6,9H,1,7-8H2,2-5H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | PHNPFUAYVBEGAJ-VIFPVBQESA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.488°C at 760 mmHg (Cal.) |
| Flash point | 156.698°C (Cal.) |
| Refractive index | 1.454 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl (3S)-3-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)Butanoate |