|
CAS#: 35467-98-2 Product: 4-Methoxy-2-(2-Nitroethenyl)Phenol No suppilers available for the product. |
| Name | 4-Methoxy-2-(2-Nitroethenyl)Phenol |
|---|---|
| Synonyms | 4-Methoxy-2-[(E)-2-Nitroethenyl]Phenol; 4-Methoxy-2-[(E)-2-Nitrovinyl]Phenol; 4-Methoxy-2-(2-Nitrovinyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 |
| CAS Registry Number | 35467-98-2 |
| SMILES | C1=C(C=CC(=C1\C=C\[N+](=O)[O-])O)OC |
| InChI | 1S/C9H9NO4/c1-14-8-2-3-9(11)7(6-8)4-5-10(12)13/h2-6,11H,1H3/b5-4+ |
| InChIKey | XHZXDCADXNMUGF-SNAWJCMRSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.858°C at 760 mmHg (Cal.) |
| Flash point | 181.717°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-2-(2-Nitroethenyl)Phenol |