Online Database of Chemicals from Around the World
|
CAS#: 35528-76-8 Product: 4,4,4',4',5,5,5',5'-Octamethyl-2,2'-Bi-1,3-Dioxolane No suppilers available for the product. |
| Name | 4,4,4',4',5,5,5',5'-Octamethyl-2,2'-Bi-1,3-Dioxolane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35 |
| CAS Registry Number | 35528-76-8 |
| SMILES | O1C(C(OC1C2OC(C(O2)(C)C)(C)C)(C)C)(C)C |
| InChI | 1S/C14H26O4/c1-11(2)12(3,4)16-9(15-11)10-17-13(5,6)14(7,8)18-10/h9-10H,1-8H3 |
| InChIKey | HYPIGPGMMNBRNQ-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.928°C at 760 mmHg (Cal.) |
| Flash point | 64.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,4',4',5,5,5',5'-Octamethyl-2,2'-Bi-1,3-Dioxolane |