Online Database of Chemicals from Around the World
|
CAS#: 3566-76-5 Product: (2,2-Dichloro-1-Dimethoxyphosphorylethenyl) Acetate No suppilers available for the product. |
| Name | (2,2-Dichloro-1-Dimethoxyphosphorylethenyl) Acetate |
|---|---|
| Synonyms | (2,2-Dichloro-1-Dimethoxyphosphoryl-Vinyl) Acetate; Acetic Acid (2,2-Dichloro-1-Dimethoxyphosphorylvinyl) Ester; Acetic Acid (2,2-Dichloro-1-Dimethoxyphosphoryl-Vinyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C6H9Cl2O5P |
| Molecular Weight | 263.01 |
| CAS Registry Number | 3566-76-5 |
| SMILES | CC(OC([P](=O)(OC)OC)=C(Cl)Cl)=O |
| InChI | 1S/C6H9Cl2O5P/c1-4(9)13-6(5(7)8)14(10,11-2)12-3/h1-3H3 |
| InChIKey | MBRBXYPIKYUZFW-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.933°C at 760 mmHg (Cal.) |
| Flash point | 105.442°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,2-Dichloro-1-Dimethoxyphosphorylethenyl) Acetate |