Online Database of Chemicals from Around the World
|
CAS#: 3571-31-1 Product: 1,8-Dihydroxy-3-Methoxy-6-Methyl-10H-Anthracen-9-One No suppilers available for the product. |
| Name | 1,8-Dihydroxy-3-Methoxy-6-Methyl-10H-Anthracen-9-One |
|---|---|
| Synonyms | Nsc179488; 1,8-Dihydroxy-3-Methoxy-6-Methylanthrone; 4-06-00-07808 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Registry Number | 3571-31-1 |
| SMILES | C3=C2CC1=CC(=CC(=C1C(=O)C2=C(O)C=C3C)O)OC |
| InChI | 1S/C16H14O4/c1-8-3-9-5-10-6-11(20-2)7-13(18)15(10)16(19)14(9)12(17)4-8/h3-4,6-7,17-18H,5H2,1-2H3 |
| InChIKey | DRQZSQDHMHEDQS-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.581°C at 760 mmHg (Cal.) |
| Flash point | 210.135°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dihydroxy-3-Methoxy-6-Methyl-10H-Anthracen-9-One |