Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 | www.purerechem.com | |||
 | +86 (551) 6288-8437 +86 18096409024 | |||
 | info@purerechem.com | |||
 | QQ Chat | |||
 | Skype Chat | |||
 | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Brivaracetam (alfaR, 4R)-Isomer |
|---|---|
| Synonyms | 2-(2-oxo-4-propylpyrrolidin-1-yl)butanamide |
| Molecular Structure |  |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 357337-00-9 |
| SMILES | CCCC1CC(=O)N(C1)C(CC)C(=O)N |
| Solubility | 6344 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.494, Calc.* |
| Melting point | 161.40 °C |
| Boiling Point | 398.48 °C, 409.3±28.0 °C (760 mmHg), Calc.* |
| Flash Point | 201.3±24.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Brivaracetam (alfaR, 4R)-Isomer |