Online Database of Chemicals from Around the World
|
CAS#: 35825-29-7 Product: Cyclopropyl(Triisopropyl)Stannane No suppilers available for the product. |
| Name | Cyclopropyl(Triisopropyl)Stannane |
|---|---|
| Synonyms | Cyclopropyl(triisopropyl)stannane # |
| Molecular Structure |  |
| Molecular Formula | C12H26Sn |
| Molecular Weight | 289.04 |
| CAS Registry Number | 35825-29-7 |
| SMILES | C([Sn](C(C)C)(C(C)C)C1CC1)(C)C |
| InChI | 1S/C3H5.3C3H7.Sn/c1-2-3-1;3*1-3-2;/h1H,2-3H2;3*3H,1-2H3; |
| InChIKey | DSVMHGVWZQNRQY-UHFFFAOYSA-N |
| Boiling point | 251.891°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.863°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclopropyl(Triisopropyl)Stannane |