Online Database of Chemicals from Around the World
|
CAS#: 35860-31-2 Product: N-(2,3,4,5,6-Pentanitrophenyl)-N-Phenylnitramide No suppilers available for the product. |
| Name | N-(2,3,4,5,6-Pentanitrophenyl)-N-Phenylnitramide |
|---|---|
| Synonyms | N-(2,3,4,5,6-Pentanitrophenyl)-N-Phenyl-Nitramide; N-Phenylbenzeneamine Hexanitro Deriv.; Benzeneamine, N-Phenyl-, Hexanitro Deriv. |
| Molecular Structure |  |
| Molecular Formula | C12H5N7O12 |
| Molecular Weight | 439.21 |
| CAS Registry Number | 35860-31-2 |
| SMILES | C1=CC=CC=C1N(C2=C(C(=C(C(=C2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C12H5N7O12/c20-14(21)8-7(13(19(30)31)6-4-2-1-3-5-6)9(15(22)23)11(17(26)27)12(18(28)29)10(8)16(24)25/h1-5H |
| InChIKey | FBKMMHXBVSAMPC-UHFFFAOYSA-N |
| Density | 1.914g/cm3 (Cal.) |
|---|---|
| Boiling point | 730.045°C at 760 mmHg (Cal.) |
| Flash point | 395.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,3,4,5,6-Pentanitrophenyl)-N-Phenylnitramide |