| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-(Trifluoromethyl)-3,3,3-Trifluoropropionate |
|---|---|
| Synonyms | 3,3,3-Trifluoro-2-(Trifluoromethyl)Propanoic Acid Methyl Ester; 3,3,3-Trifluoro-2-(Trifluoromethyl)Propionic Acid Methyl Ester; 4-02-00-00856 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4F6O2 |
| Molecular Weight | 210.08 |
| CAS Registry Number | 360-54-3 |
| SMILES | COC(C(C(F)(F)F)C(F)(F)F)=O |
| InChI | 1S/C5H4F6O2/c1-13-3(12)2(4(6,7)8)5(9,10)11/h2H,1H3 |
| InChIKey | JGGBVFLRNNDHCM-UHFFFAOYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 90-91°C (Expl.) |
| 93.866°C at 760 mmHg (Cal.) | |
| Flash point | 60°C (Expl.) |
| 12.433°C (Cal.) | |
| Refractive index | 1.269 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(Trifluoromethyl)-3,3,3-Trifluoropropionate |