|
CAS#: 3605-31-0 Product: 5-Tert-Butyl-3,3-Dimethyl-1,2-Dihydroindene No suppilers available for the product. |
| Name | 5-Tert-Butyl-3,3-Dimethyl-1,2-Dihydroindene |
|---|---|
| Synonyms | 6-Tert-Butyl-1,1-Dimethyl-Indane; 6-Tert-Butyl-1,1-Dimethylindane; 1,1-Dimethyl-6-(1,1-Dimethylethyl)Indane |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 |
| CAS Registry Number | 3605-31-0 |
| EINECS | 222-765-1 |
| SMILES | C1=CC(=CC2=C1CCC2(C)C)C(C)(C)C |
| InChI | 1S/C15H22/c1-14(2,3)12-7-6-11-8-9-15(4,5)13(11)10-12/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | ZGPWHILODVHWKJ-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.94°C at 760 mmHg (Cal.) |
| Flash point | 94.143°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Tert-Butyl-3,3-Dimethyl-1,2-Dihydroindene |