Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1,1,3,3,3-Hexachloropropane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C3H2Cl6 |
| Molecular Weight | 250.77 |
| CAS Registry Number | 3607-78-1 |
| SMILES | C(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C3H2Cl6/c4-2(5,6)1-3(7,8)9/h1H2 |
| InChIKey | BBEAZDGZMVABIC-UHFFFAOYSA-N |
| Density | 1.712g/cm3 (Cal.) |
|---|---|
| Boiling point | 211.764°C at 760 mmHg (Cal.) |
| Flash point | 80.126°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,3,3-Hexachloropropane |