Online Database of Chemicals from Around the World
|
CAS#: 3608-79-5 Product: [(2-Ethylpyridin-4-Yl)Methylideneamino]Thiourea No suppilers available for the product. |
| Name | [(2-Ethylpyridin-4-Yl)Methylideneamino]Thiourea |
|---|---|
| Synonyms | [(2-Ethyl-4-Pyridyl)Methyleneamino]Thiourea; 2-Ethyl-4-Formylpyridine Thiosemicarbazone; 5-21-07-00423 (Beilstein Handbook Reference) |
| Molecular Structure | ![CAS#: 3608-79-5， [(2-Ethylpyridin-4-Yl)Methylideneamino]Thiourea](/moreStructures/3608-79-5.gif) |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.28 |
| CAS Registry Number | 3608-79-5 |
| SMILES | C1=C(/C=N/NC(=S)N)C=CN=C1CC |
| InChI | 1S/C9H12N4S/c1-2-8-5-7(3-4-11-8)6-12-13-9(10)14/h3-6H,2H2,1H3,(H3,10,13,14)/b12-6+ |
| InChIKey | PFCNIHAUOWBJQR-WUXMJOGZSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.86°C at 760 mmHg (Cal.) |
| Flash point | 172.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2-Ethylpyridin-4-Yl)Methylideneamino]Thiourea |