Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| IRIS Biotech GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (9231) 961-973 | |||
|
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Name | Cytochalasin F |
|---|---|
| Synonyms | 24-Oxa(14)Cytochalasa-13,21-Diene-1,23-Dione, 6,7-Epoxy-20-Hydroxy-16-Methyl-10-Phenyl-, (7S,13E,16R,20R,21E)-; Cytochalasin F |
| Molecular Structure |  |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 |
| CAS Registry Number | 36084-18-1 |
| SMILES | C5=C(CC3NC(=O)C14OC(=O)\C=C\C(O)CCCC(C/C=C/C1C2OC2(C(C34)C)C)C)C=CC=C5 |
| InChI | 1S/C29H37NO5/c1-18-9-7-13-21(31)15-16-24(32)34-29-22(14-8-10-18)26-28(3,35-26)19(2)25(29)23(30-27(29)33)17-20-11-5-4-6-12-20/h4-6,8,11-12,14-16,18-19,21-23,25-26,31H,7,9-10,13,17H2,1-3H3,(H,30,33)/b14-8+,16-15+ |
| InChIKey | CXWYFIYZAZBQGQ-LFKALUBKSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 709.926°C at 760 mmHg (Cal.) |
| Flash point | 383.149°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cytochalasin F |