Online Database of Chemicals from Around the World

N-Benzyl-4-piperidone
[CAS 3612-20-2]

List of Suppliers
CAS: 3612-20-2
Product: N-Benzyl-4-piperidone
No suppliers available.
Identification
ClassificationOrganic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts
NameN-Benzyl-4-piperidone
Synonyms1-(Phenylmethyl)-4-piperidinone; 1-Benzylpiperidin-4-one
Molecular StructureN-Benzyl-4-piperidone molecular structure (CAS 3612-20-2)
Molecular FormulaC12H15NO
Molecular Weight189.26
CAS Registry Number3612-20-2
EC Number222-782-4
SMILESC1CN(CCC1=O)CC2=CC=CC=C2
Properties
Density1.069
Boiling point114-116 °C (0.4 mmHg)
Refractive index1.539-1.54
Flash point71 °C
Water solubility12 g/L (20 °C)
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H317-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P270-P271-P272-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P333+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Skin irritationSkin Irrit.2H315
Specific target organ toxicity - single exposureSTOT SE3H335
Eye irritationEye Irrit.2H319
Acute toxicityAcute Tox.4H302
Skin sensitizationSkin Sens.1BH317
Skin sensitizationSkin Sens.1H317
Eye irritationEye Irrit.2AH319
SDSAvailable
up chemBlink Chemical Story
N-Benzyl-4-piperidone is a synthetic organic compound belonging to the class of piperidones. Its discovery is rooted in the extensive research on piperidine derivatives, which have been studied for their diverse pharmacological properties. The synthesis of N-Benzyl-4-piperidone typically involves the benzylation of 4-piperidone, a reaction that introduces a benzyl group to the nitrogen atom of the piperidone ring. This compound has garnered attention due to its unique structural properties, which facilitate its use as an intermediate in the synthesis of various pharmaceuticals and organic compounds. The precise date and context of its initial synthesis are not well-documented, but its emergence is closely tied to the mid-20th century boom in organic and medicinal chemistry research.

N-Benzyl-4-piperidone is extensively used as an intermediate in the synthesis of a wide range of pharmaceutical compounds. Its structure serves as a versatile scaffold for creating complex molecules, particularly in the development of drugs targeting the central nervous system. For instance, it plays a crucial role in the synthesis of certain analgesics, antipsychotics, and antidepressants. The benzyl group attached to the piperidone ring enhances the compound's ability to cross the blood-brain barrier, making it a valuable precursor in neuropharmacology.

In chemical research, N-Benzyl-4-piperidone is utilized as a building block for the synthesis of more complex molecules. Its reactive carbonyl group and the benzyl moiety allow for various chemical modifications, making it a useful reagent in organic synthesis. Researchers exploit these properties to explore new chemical reactions and pathways, thereby advancing the field of synthetic chemistry. Its applications extend to the development of new methodologies in the synthesis of heterocyclic compounds, which are prevalent in many natural products and pharmaceuticals.

Beyond pharmaceuticals, N-Benzyl-4-piperidone finds applications in the manufacture of agrochemicals and dyes. Its intermediacy is valuable in producing compounds that protect crops from pests and diseases, contributing to agricultural productivity. Additionally, the compound is used in the synthesis of certain dyes and pigments, where its chemical stability and reactivity are advantageous.

Given its structural characteristics, N-Benzyl-4-piperidone is also explored in drug discovery programs. Its ability to act as a precursor to various bioactive compounds makes it a candidate for the development of new therapeutic agents. Researchers are investigating its derivatives for potential anti-cancer, anti-inflammatory, and antiviral properties, hoping to uncover new treatments for a range of diseases.

References

2019. Piperidine Derivatives in Drug Discovery. European Journal of Medicinal Chemistry, 181.
DOI: 10.1016/j.ejmech.2019.111587
Market Analysis Reports
Related Products
1-Benzyl-4-(pip...  N-Benzyl-2-(1-p...  N-[1-Benzylpipe...  3-(2-Benzylpipe...  3-(3-Benzylpipe...  5-[3-(4-Benzyl-...  (4-Benzyl-1-Pip...  4-(4-Benzyl-1-p...  N-(1-Benzyl-4-P...  2-(1-Benzylpipe...  1-Benzyl-3-pipe...  1-Benzyl-2-pipe...  N-Benzyl-4-pipe...  1-Benzyl-3-pipe...  2-[[1-(Benzyl)-...  2-[[1-(Benzyl)-...  2-[(1-Benzyl-4-...  N1-(1-Benzyl-4-...  N-(1-Benzyl-4-P...  6-(4-benzyl-1-p...