|
CAS#: 362601-75-0 Product: 5-Amino-3-Methyl-1-(2,4,6-Trichlorophenyl)-1H-Pyrazole-4-Carbonitrile No suppilers available for the product. |
| Name | 5-Amino-3-Methyl-1-(2,4,6-Trichlorophenyl)-1H-Pyrazole-4-Carbonitrile |
|---|---|
| Synonyms | 5-Amino-3-methyl-1-(2,4,6-trichlorophenyl)-1H; 5-Amino-3 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Cl3N4 |
| Molecular Weight | 301.56 |
| CAS Registry Number | 362601-75-0 |
| SMILES | Clc1c(c(Cl)cc(Cl)c1)n2nc(c(C#N)c2N)C |
| InChI | 1S/C11H7Cl3N4/c1-5-7(4-15)11(16)18(17-5)10-8(13)2-6(12)3-9(10)14/h2-3H,16H2,1H3 |
| InChIKey | OWQGHRDFFLJOGF-UHFFFAOYSA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.257°C at 760 mmHg (Cal.) |
| Flash point | 247.879°C (Cal.) |
| Refractive index | 1.695 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Amino-3-Methyl-1-(2,4,6-Trichlorophenyl)-1H-Pyrazole-4-Carbonitrile |