|
CAS#: 3645-61-2 Product: Sodium 4-Phenylphenolate No suppilers available for the product. |
| Name | Sodium 4-Phenylphenolate |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4-Ol, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NaO |
| Molecular Weight | 192.19 |
| CAS Registry Number | 3645-61-2 |
| SMILES | C1=CC(=CC=C1[O-])C2=CC=CC=C2.[Na+] |
| InChI | 1S/C12H10O.Na/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9,13H;/q;+1/p-1 |
| InChIKey | PJOIPAGEBPZNSD-UHFFFAOYSA-M |
| Boiling point | 306.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 147.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-Phenylphenolate |