|
CAS#: 364742-59-6 Product: N-(4-Cyanophenyl)-3-Methoxybenzamide No suppilers available for the product. |
| Name | N-(4-Cyanophenyl)-3-Methoxybenzamide |
|---|---|
| Synonyms | BENZAMIDE,N-(4-CYANOPHENYL)-3-METHOXY-; N-(4-cyanophenyl)(3-methoxyphenyl)carboxamide; ZINC00138209 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 364742-59-6 |
| SMILES | COC1=CC=CC(=C1)C(=O)NC2=CC=C(C=C2)C#N |
| InChI | 1S/C15H12N2O2/c1-19-14-4-2-3-12(9-14)15(18)17-13-7-5-11(10-16)6-8-13/h2-9H,1H3,(H,17,18) |
| InChIKey | AKTCDVUQNNUSNC-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.9±27.0°C at 760 mmHg (Cal.) |
| Flash point | 174.5±23.7°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Cyanophenyl)-3-Methoxybenzamide |