Online Database of Chemicals from Around the World
|
CAS#: 36504-66-2 Product: Benzo[a]Pyrene-9,10-Epoxide No suppilers available for the product. |
| Name | Benzo[a]Pyrene-9,10-Epoxide |
|---|---|
| Synonyms | Benzo[A]Pyrene-9,10-Oxide; C14849; 5-17-02-00533 (Beilstein Handbook Reference) |
| Molecular Structure | ![CAS#: 36504-66-2， Benzo[a]Pyrene-9,10-Epoxide](/moreStructures/36504-66-2.gif) |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 |
| CAS Registry Number | 36504-66-2 |
| SMILES | C1=C6C(=C4C2=C1C=CC3=C2C(=CC=C3)C=C4)C5C(O5)C=C6 |
| InChI | 1S/C20H12O/c1-2-11-4-5-13-10-14-7-9-16-20(21-16)19(14)15-8-6-12(3-1)17(11)18(13)15/h1-10,16,20H |
| InChIKey | GOEJUYABKOTLJA-UHFFFAOYSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.581°C at 760 mmHg (Cal.) |
| Flash point | 241.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[a]Pyrene-9,10-Epoxide |