Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Chloro-3,5-Difluoro-2-Nitro-Benzene |
|---|---|
| Synonyms | 1-Chloro-3,5-Difluoro-2-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C6H2ClF2NO2 |
| Molecular Weight | 193.54 |
| CAS Registry Number | 36556-55-5 |
| EINECS | 253-100-3 |
| SMILES | C1=C(F)C=C(F)C(=C1Cl)[N+]([O-])=O |
| InChI | 1S/C6H2ClF2NO2/c7-4-1-3(8)2-5(9)6(4)10(11)12/h1-2H |
| InChIKey | MWYQVPGRHISKQU-UHFFFAOYSA-N |
| Density | 1.591g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.372°C at 760 mmHg (Cal.) |
| Flash point | 97.36°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3,5-Difluoro-2-Nitro-Benzene |