Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Benzoyl Chloride 4-Chloro- Phenylhydrazone |
|---|---|
| Synonyms | 4-Chloro-N-(Phenylamino)Benzimidoyl Chloride; 4-Chlorobenzoyl Chloride Phenyl Hydrazone; Benzoyl Chloride, P-Chloro-, Phenylhydrazone |
| Molecular Structure |  |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 |
| CAS Registry Number | 36590-52-0 |
| SMILES | C2=C(/C(Cl)=N/NC1=CC=CC=C1)C=CC(=C2)Cl |
| InChI | 1S/C13H10Cl2N2/c14-11-8-6-10(7-9-11)13(15)17-16-12-4-2-1-3-5-12/h1-9,16H/b17-13- |
| InChIKey | ILBQKBQMVGVLIN-LGMDPLHJSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.16°C at 760 mmHg (Cal.) |
| Flash point | 177.062°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzoyl Chloride 4-Chloro- Phenylhydrazone |