Online Database of Chemicals from Around the World
|
CAS#: 3665-11-0 Product: 4-Bromo-N-Hydroxy-N-Methylbenzenesulfonamide No suppilers available for the product. |
| Name | 4-Bromo-N-Hydroxy-N-Methylbenzenesulfonamide |
|---|---|
| Synonyms | 4-Bromo-N-Hydroxy-N-Methyl-Benzenesulfonamide; Brn 2648110; Benzenesulfonamide, P-Bromo-N-Hydroxy-N-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C7H8BrNO3S |
| Molecular Weight | 266.11 |
| CAS Registry Number | 3665-11-0 |
| SMILES | C1=CC(=CC=C1[S](=O)(=O)N(C)O)Br |
| InChI | 1S/C7H8BrNO3S/c1-9(10)13(11,12)7-4-2-6(8)3-5-7/h2-5,10H,1H3 |
| InChIKey | MHBVPAVQIFRARH-UHFFFAOYSA-N |
| Density | 1.749g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.372°C at 760 mmHg (Cal.) |
| Flash point | 185.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-N-Hydroxy-N-Methylbenzenesulfonamide |