| Shandong Benrite New Chemical Materials Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.benritechem.com | |||
![]() | +86 (0533) 286-6658 | |||
![]() | sales@benritechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: benritechem | |||
![]() | WhatsApp:+8613021512891 | |||
| Chemical distributor since 2024 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Heterocyclic compound |
|---|---|
| Name | 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide |
| Synonyms | 2,4,8,10-tetraoxa-3λ4,9λ4-dithiaspiro[5.5]undecane 3,9-dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8O6S2 |
| Molecular Weight | 228.24 |
| CAS Registry Number | 3670-93-7 |
| EC Number | 222-933-4 |
| SMILES | C1C2(COS(=O)O1)COS(=O)OC2 |
| Density | 1.9±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.682, Calc.* |
| Boiling Point | 395.1±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 192.8±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide, commonly referred to as a spirocyclic compound, is a fascinating chemical substance that has garnered attention due to its unique structure and potential applications in various fields. This compound belongs to the class of heterocyclic compounds, which are characterized by their inclusion of different elements within their ring structures, such as oxygen and sulfur in this case. The name reflects the specific arrangement of oxygen (O) and sulfur (S) atoms within a spiro system, a molecular structure where two rings are connected at a single atom. The discovery of 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide is an important milestone in the development of spirocyclic compounds. These compounds have intrigued researchers for decades due to their distinctive chemical properties and the challenges associated with their synthesis. The combination of both oxygen and sulfur in the same molecular framework imparts interesting properties to the compound, such as increased stability and the potential for coordination with metal ions, making them suitable candidates for various chemical reactions and material applications. The initial discovery of this compound likely stems from studies on sulfur-oxygen heterocycles and their role in the design of new materials, pharmaceuticals, and catalysts. Its unique spirocyclic structure provides a platform for further exploration in synthetic chemistry, particularly in designing new ligands for metal ions. These types of compounds have shown promise in the development of catalysts for organic reactions and in the design of materials with specialized properties, such as conducting polymers or materials for energy storage. In addition to its potential as a catalyst or material component, 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide has shown potential in pharmaceutical applications. The presence of both sulfur and oxygen atoms within the same molecular structure offers the possibility of interacting with biological systems in novel ways, especially in the development of drug candidates. Researchers have explored its use in the creation of targeted drug delivery systems, where the compound's ability to coordinate with metal ions could be leveraged to transport therapeutic agents to specific sites in the body. Furthermore, its structure offers a basis for the creation of compounds with unique electronic and optical properties. The functionalization of the spirocyclic scaffold could lead to the development of sensors or other devices that utilize its ability to interact with light or electrical fields, broadening its application in fields such as electronics, nanotechnology, and environmental monitoring. While much of the research into 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide is still in the early stages, its potential is undeniable. As researchers continue to explore its properties and applications, it is likely that this compound will find use in a range of fields, from materials science to medicine, helping to drive forward innovations in these areas. References none |
| Market Analysis Reports |
| List of Reports Available for 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,9-dioxide |