Online Database of Chemicals from Around the World
|
CAS#: 3671-00-9 Product: 3-(1-Methylpyrrolidin-3-Yl)-1H-Indole No suppilers available for the product. |
| Name | 3-(1-Methylpyrrolidin-3-Yl)-1H-Indole |
|---|---|
| Synonyms | 3-(1-Methyl-3-Pyrrolidinyl)-1H-Indole; Mls000736581; Smr000528205 |
| Molecular Structure |  |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 3671-00-9 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2)C3CCN(C3)C |
| InChI | 1S/C13H16N2/c1-15-7-6-10(9-15)12-8-14-13-5-3-2-4-11(12)13/h2-5,8,10,14H,6-7,9H2,1H3 |
| InChIKey | GIUCRWSFDBHBDT-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.61°C at 760 mmHg (Cal.) |
| Flash point | 172.496°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Methylpyrrolidin-3-Yl)-1H-Indole |