|
CAS#: 36913-04-9 Product: (2S)-N,N-Dimethyl-1-Phenyl-2-Propanamine Hydrochloride (1:1) No suppilers available for the product. |
| Name | (2S)-N,N-Dimethyl-1-Phenyl-2-Propanamine Hydrochloride (1:1) |
|---|---|
| Synonyms | (S)-N,N,α-trimethylphenethylamine hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 |
| CAS Registry Number | 36913-04-9 |
| EINECS | 253-269-3 |
| SMILES | Cl.CN(C)[C@@H](C)Cc1ccccc1 |
| InChI | 1S/C11H17N.ClH/c1-10(12(2)3)9-11-7-5-4-6-8-11;/h4-8,10H,9H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | UTWYKDPIWNRKCN-PPHPATTJSA-N |
| Boiling point | 260.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 111.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-N,N-Dimethyl-1-Phenyl-2-Propanamine Hydrochloride (1:1) |