|
CAS#: 369625-84-3 Product: [3,5-Bis(Trifluoromethyl)Phenyl]Acetaldehyde No suppilers available for the product. |
| Name | [3,5-Bis(Trifluoromethyl)Phenyl]Acetaldehyde |
|---|---|
| Synonyms | 2-(3,5-Bis(trifluoromethyl)phenyl)acetaldehyde; BENZENEACETALDEHYDE,3,5-BIS(TRIFLUOROMETHYL)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6F6O |
| Molecular Weight | 256.14 |
| CAS Registry Number | 369625-84-3 |
| SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)CC=O |
| InChI | 1S/C10H6F6O/c11-9(12,13)7-3-6(1-2-17)4-8(5-7)10(14,15)16/h2-5H,1H2 |
| InChIKey | TXJWMEJYJVYJPT-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 183.03°C at 760 mmHg (Cal.) |
| Flash point | 66.949°C (Cal.) |
| Refractive index | 1.407 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3,5-Bis(Trifluoromethyl)Phenyl]Acetaldehyde |