Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Methyl 2-Bromo-3,5-Dinitrobenzoate |
|---|---|
| Synonyms | Benzoic acid, 2-bromo-3,5-dinitro-, methyl ester; methyl 2-bromo-3,5-dinitrobenzoate; NSC159525 |
| Molecular Structure |  |
| Molecular Formula | C8H5BrN2O6 |
| Molecular Weight | 305.04 |
| CAS Registry Number | 3697-38-9 |
| EINECS | 223-025-0 |
| SMILES | O=[N+]([O-])c1cc(cc(C(=O)OC)c1Br)[N+]([O-])=O |
| InChI | 1S/C8H5BrN2O6/c1-17-8(12)5-2-4(10(13)14)3-6(7(5)9)11(15)16/h2-3H,1H3 |
| InChIKey | XSJXJYYYTKHXQW-UHFFFAOYSA-N |
| Density | 1.824g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.464°C at 760 mmHg (Cal.) |
| Flash point | 171.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Bromo-3,5-Dinitrobenzoate |