Online Database of Chemicals from Around the World
| Name | 1-Nitro-3-(Trifluoromethylsulfanyl)Benzene |
|---|---|
| Synonyms | 1-Nitro-3-(Trifluoromethylthio)Benzene; Benzene, 1-Nitro-3-((Trifluoromethyl)Thio)- |
| Molecular Structure |  |
| Molecular Formula | C7H4F3NO2S |
| Molecular Weight | 223.17 |
| CAS Registry Number | 370-47-8 |
| EINECS | 206-727-1 |
| SMILES | C1=CC=C(C=C1SC(F)(F)F)[N+]([O-])=O |
| InChI | 1S/C7H4F3NO2S/c8-7(9,10)14-6-3-1-2-5(4-6)11(12)13/h1-4H |
| InChIKey | LCYLLPJRCOQTHG-UHFFFAOYSA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 180.727°C at 760 mmHg (Cal.) |
| Flash point | 63.102°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-3-(Trifluoromethylsulfanyl)Benzene |
