Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(Perfluorobutanoyl)Cyclohexanone |
|---|---|
| Synonyms | 2-(2,2,3,3,4,4,4-Heptafluoro-1-Oxobutyl)-1-Cyclohexanone; Nsc42770 |
| Molecular Structure |  |
| Molecular Formula | C10H9F7O2 |
| Molecular Weight | 294.17 |
| CAS Registry Number | 37172-87-5 |
| SMILES | O=C1CCCCC1C(=O)C(F)(F)C(C(F)(F)F)(F)F |
| InChI | 1S/C10H9F7O2/c11-8(12,9(13,14)10(15,16)17)7(19)5-3-1-2-4-6(5)18/h5H,1-4H2 |
| InChIKey | UIGUVAREBFMONS-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 233.533°C at 760 mmHg (Cal.) |
| Flash point | 88.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Perfluorobutanoyl)Cyclohexanone |