Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(Acetyl-Phenylamino)-N,N-Dimethylacetamide |
|---|---|
| Synonyms | 2-(Acetyl-Phenyl-Amino)-N,N-Dimethyl-Acetamide; 2-(Ethanoyl-Phenyl-Amino)-N,N-Dimethyl-Ethanamide; Phenylacetylglycine Dimethylamide |
| Molecular Structure |  |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 3738-06-5 |
| SMILES | C1=CC=CC=C1N(CC(N(C)C)=O)C(C)=O |
| InChI | 1S/C12H16N2O2/c1-10(15)14(9-12(16)13(2)3)11-7-5-4-6-8-11/h4-8H,9H2,1-3H3 |
| InChIKey | KEVKBVWYVMVEBG-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.565°C at 760 mmHg (Cal.) |
| Flash point | 152.659°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Acetyl-Phenylamino)-N,N-Dimethylacetamide |