|
CAS#: 37689-86-4 Product: (4-Nitrophenyl) Carbamate No suppilers available for the product. |
| Name | (4-Nitrophenyl) Carbamate |
|---|---|
| Synonyms | Carbamic Acid (4-Nitrophenyl) Ester; 4-Nitrophenylcarbamate; Carbamic Acid, 4-Nitrophenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.14 |
| CAS Registry Number | 37689-86-4 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)OC(N)=O |
| InChI | 1S/C7H6N2O4/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-4H,(H2,8,10) |
| InChIKey | QHFKWIKCUHNXAU-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.138°C at 760 mmHg (Cal.) |
| Flash point | 192.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Nitrophenyl) Carbamate |