Online Database of Chemicals from Around the World
|
CAS#: 37809-02-2 Product: (2S)-1-Chloro-2-Nitropropane No suppilers available for the product. |
| Name | (2S)-1-Chloro-2-Nitropropane |
|---|---|
| Synonyms | (2S)-1-Chloro-2-Nitro-Propane; Propane, Chloronitro- |
| Molecular Structure |  |
| Molecular Formula | C3H6ClNO2 |
| Molecular Weight | 123.54 |
| CAS Registry Number | 37809-02-2 |
| SMILES | [C@H](CCl)([N+]([O-])=O)C |
| InChI | 1S/C3H6ClNO2/c1-3(2-4)5(6)7/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | FPJNQQRSBJPGHM-VKHMYHEASA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.239°C at 760 mmHg (Cal.) |
| Flash point | 59.783°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-1-Chloro-2-Nitropropane |