Online Database of Chemicals from Around the World
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 (431) 5606-600 | |||
 |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8708-6220 | |||
|
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | Methyl 2-Chloro-3-(Trifluoromethyl)Benzoate |
|---|---|
| Synonyms | Methyl 2-chloro-3-(trifluoromethyl)benzoate; Methyl 2-Chloro-3-trifluoromethylbenzoate |
| Molecular Structure |  |
| Molecular Formula | C9H6ClF3O2 |
| Molecular Weight | 238.59 |
| CAS Registry Number | 378231-19-7 |
| SMILES | COC(=O)c1cccc(c1Cl)C(F)(F)F |
| InChI | 1S/C9H6ClF3O2/c1-15-8(14)5-3-2-4-6(7(5)10)9(11,12)13/h2-4H,1H3 |
| InChIKey | LEECXUQPLLXGGK-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.724°C at 760 mmHg (Cal.) |
| Flash point | 100.694°C (Cal.) |
| Refractive index | 1.466 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Chloro-3-(Trifluoromethyl)Benzoate |