Online Database of Chemicals from Around the World
|
CAS#: 3790-23-6 Product: Diethylphosphinothioyl-Diethyl-Sulfanylidenephosphorane No suppilers available for the product. |
| Name | Diethylphosphinothioyl-Diethyl-Sulfanylidenephosphorane |
|---|---|
| Synonyms | Diethylphosphinothioyl-Diethyl-Thioxo-Phosphorane; Diethylphosphinothioyl-Diethyl-Thioxophosphorane; Diethylthiophosphoryl-Diethyl-Thioxo-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C8H20P2S2 |
| Molecular Weight | 242.31 |
| CAS Registry Number | 3790-23-6 |
| EINECS | 223-261-4 |
| SMILES | C([P]([P](=S)(CC)CC)(=S)CC)C |
| InChI | 1S/C8H20P2S2/c1-5-9(11,6-2)10(12,7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | LNMKVDPXBCIMOU-UHFFFAOYSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.021°C at 760 mmHg (Cal.) |
| Flash point | 136.458°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylphosphinothioyl-Diethyl-Sulfanylidenephosphorane |