|
CAS#: 37941-54-1 Product: N2,N6-Bis[(Benzyloxy)Carbonyl]-L-Lysylglycine No suppilers available for the product. |
| Name | N2,N6-Bis[(Benzyloxy)Carbonyl]-L-Lysylglycine |
|---|---|
| Synonyms | Z-LYS(Z)-GLY-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.50 |
| CAS Registry Number | 37941-54-1 |
| SMILES | O=C(O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)CCCCNC(=O)OCc2ccccc2 |
| InChI | 1S/C24H29N3O7/c28-21(29)15-26-22(30)20(27-24(32)34-17-19-11-5-2-6-12-19)13-7-8-14-25-23(31)33-16-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,25,31)(H,26,30)(H,27,32)(H,28,29)/t20-/m0/s1 |
| InChIKey | YMHXRKMCTBMGTQ-FQEVSTJZSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 780.19°C at 760 mmHg (Cal.) |
| Flash point | 425.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2,N6-Bis[(Benzyloxy)Carbonyl]-L-Lysylglycine |