Online Database of Chemicals from Around the World
|
CAS#: 38143-10-1 Product: N1,N2-Methylenelunarine No suppilers available for the product. |
| Name | N1,N2-Methylenelunarine |
|---|---|
| Synonyms | N1,N2-Methyleneuvarine; Nsc225288 |
| Molecular Structure |  |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 |
| CAS Registry Number | 38143-10-1 |
| SMILES | N14CN(CCC1)CCCCNC(=O)\C=C/C25C(OC3=C2C=C(C=C3)\C=C/C4=O)CC(=O)CC5 |
| InChI | 1S/C26H31N3O4/c30-20-8-10-26-11-9-24(31)27-12-1-2-13-28-14-3-15-29(18-28)25(32)7-5-19-4-6-22(21(26)16-19)33-23(26)17-20/h4-7,9,11,16,23H,1-3,8,10,12-15,17-18H2,(H,27,31)/b7-5-,11-9- |
| InChIKey | QRISBUREZACXLK-CXHWBCNXSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 756.969°C at 760 mmHg (Cal.) |
| Flash point | 411.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N1,N2-Methylenelunarine |