Online Database of Chemicals from Around the World
|
CAS#: 38211-56-2 Product: Precoccinelline No suppilers available for the product. |
| Name | Precoccinelline |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 |
| CAS Registry Number | 38211-56-2 |
| SMILES | [C@H]13N2[C@H](CC(C1)C)CCCC2CCC3 |
| InChI | 1S/C13H23N/c1-10-8-12-6-2-4-11-5-3-7-13(9-10)14(11)12/h10-13H,2-9H2,1H3/t10?,11?,12-,13+ |
| InChIKey | MOQNYBQLQBMEKL-BPNZPQAUSA-N |
| Density | 0.987g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.45°C at 760 mmHg (Cal.) |
| Flash point | 98.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Precoccinelline |