Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(4-Aminophenyl)Pentan-1-One |
|---|---|
| Synonyms | Brn 2803365; Valerophenone, 4'-Amino-; Valerophenone, P-Amino- |
| Molecular Structure |  |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 38237-74-0 |
| SMILES | C1=C(C=CC(=C1)C(=O)CCCC)N |
| InChI | 1S/C11H15NO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4,12H2,1H3 |
| InChIKey | ODSCUBSJIFLFPF-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.944°C at 760 mmHg (Cal.) |
| Flash point | 153.95°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Aminophenyl)Pentan-1-One |