| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Laboratory of Technological Processes Faculty of Chemistry Warsaw University of Technology | Poland | Inquire | ||
|---|---|---|---|---|
![]() |
+48 (22) 621-0138 | |||
![]() |
lpt@ch.pw.edu.pl | |||
| Chemical manufacturer | ||||
| Name | Dimethyl (4S,5S)-2-Phenyl-1,3-Dioxolane-4,5-Dicarboxylate |
|---|---|
| Synonyms | (+)-Dimethyl 2,3-O-benzylidene-D-tartrate; -DIMETHYL2,3-O-BENZYLIDENE-D-TARTRATE; ZINC00120398 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 38270-70-1 |
| SMILES | O=C(OC)[C@H]1OC(O[C@@H]1C(=O)OC)c2ccccc2 |
| InChI | 1S/C13H14O6/c1-16-11(14)9-10(12(15)17-2)19-13(18-9)8-6-4-3-5-7-8/h3-7,9-10,13H,1-2H3/t9-,10-/m0/s1 |
| InChIKey | FMSYNRGOFIGJMM-UWVGGRQHSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.612°C at 760 mmHg (Cal.) |
| Flash point | 157.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (4S,5S)-2-Phenyl-1,3-Dioxolane-4,5-Dicarboxylate |