Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,6-Tribromo-Pyrene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H7Br3 |
| Molecular Weight | 438.94 |
| CAS Registry Number | 38303-36-5 |
| EINECS | 253-870-0 |
| SMILES | C2=C(Br)C1=CC=C4C3=C1C(=C2Br)C=CC3=C(Br)C=C4 |
| InChI | 1S/C16H7Br3/c17-12-6-2-8-1-3-10-13(18)7-14(19)11-5-4-9(12)15(8)16(10)11/h1-7H |
| InChIKey | XVBALZHPIPCRKD-UHFFFAOYSA-N |
| Density | 2.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.861°C at 760 mmHg (Cal.) |
| Flash point | 252.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,6-Tribromo-Pyrene |