|
CAS#: 383897-60-7 Product: 3-(2-Deoxy-beta-D-Erythro-Pentofuranosyl)-6-Methylfuro[2,3-d]Pyrimidin-2(3H)-One No suppilers available for the product. |
| Name | 3-(2-Deoxy-beta-D-Erythro-Pentofuranosyl)-6-Methylfuro[2,3-d]Pyrimidin-2(3H)-One |
|---|---|
| Synonyms | 6-METHYL- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 383897-60-7 |
| SMILES | CC1=CC2=CN(C(=O)N=C2O1)[C@H]3C[C@@H]([C@H](O3)CO)O |
| InChI | 1S/C12H14N2O5/c1-6-2-7-4-14(12(17)13-11(7)18-6)10-3-8(16)9(5-15)19-10/h2,4,8-10,15-16H,3,5H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | PRUTYPUPPIPZBT-IVZWLZJFSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.8±60.0°C at 760 mmHg (Cal.) |
| Flash point | 270.0±32.9°C (Cal.) |
| Refractive index | 1.709 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Deoxy-beta-D-Erythro-Pentofuranosyl)-6-Methylfuro[2,3-d]Pyrimidin-2(3H)-One |