| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-Methoxy-6-Nitrobenzonitrile |
|---|---|
| Synonyms | 2-Methoxy-6-Nitro-Benzonitrile; Nsc 27010; St5444623 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 |
| CAS Registry Number | 38469-85-1 |
| EINECS | 253-961-5 |
| SMILES | C1=CC=C(C(=C1[N+](=O)[O-])C#N)OC |
| InChI | 1S/C8H6N2O3/c1-13-8-4-2-3-7(10(11)12)6(8)5-9/h2-4H,1H3 |
| InChIKey | ZHJPRHIYTNVTLI-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-6-Nitrobenzonitrile |