|
CAS#: 38568-41-1 Product: Diethyl 4-Bromobenzene-1,2-Dicarboxylate No suppilers available for the product. |
| Name | Diethyl 4-Bromobenzene-1,2-Dicarboxylate |
|---|---|
| Synonyms | 4-Bromobenzene-1,2-Dicarboxylic Acid Diethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 |
| CAS Registry Number | 38568-41-1 |
| SMILES | C1=C(C(=CC=C1Br)C(=O)OCC)C(=O)OCC |
| InChI | 1S/C12H13BrO4/c1-3-16-11(14)9-6-5-8(13)7-10(9)12(15)17-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | SKEUPOHSMLHHSS-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.801°C at 760 mmHg (Cal.) |
| Flash point | 156.887°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 4-Bromobenzene-1,2-Dicarboxylate |