Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 1-Chloro-3-Phenylsulfanylbenzene |
|---|---|
| Synonyms | 1-Chloro-3-Phenylsulfanyl-Benzene; 1-Chloro-3-(Phenylthio)Benzene; Sulfide, M-Chlorophenyl Phenyl (6Ci,7Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H9ClS |
| Molecular Weight | 220.72 |
| CAS Registry Number | 38700-88-8 |
| SMILES | C2=C(SC1=CC=CC=C1)C=CC=C2Cl |
| InChI | 1S/C12H9ClS/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9H |
| InChIKey | YNJLAXHIFOICPE-UHFFFAOYSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.726°C at 760 mmHg (Cal.) |
| Flash point | 148.494°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3-Phenylsulfanylbenzene |