Online Database of Chemicals from Around the World
|
CAS#: 38748-96-8 Product: (1S,3S,4S,6R)-4,7,7-trimethylnorcaran-3-ol No suppilers available for the product. |
| Name | (1S,3S,4S,6R)-4,7,7-trimethylnorcaran-3-ol |
|---|---|
| Synonyms | (1α,3α,4β,6α)-4,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
| Molecular Structure |  |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 38748-96-8 |
| EINECS | 254-114-2 |
| SMILES | CC2(C)[C@@H]1C[C@H](C)[C@@H](O)C[C@@H]12 |
| InChI | 1S/C10H18O/c1-6-4-7-8(5-9(6)11)10(7,2)3/h6-9,11H,4-5H2,1-3H3/t6-,7+,8-,9-/m0/s1 |
| InChIKey | WHXOMZVLSNHION-KZVJFYERSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 210.59°C at 760 mmHg (Cal.) |
| Flash point | 84.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,3S,4S,6R)-4,7,7-trimethylnorcaran-3-ol |